C21H25FN4O2 — CID 165427398
8-(7-fluoro-4-methylquinolin-2-yl)-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 165427398) has the molecular formula C21H25FN4O2 and a molecular weight of 384.46 g/mol. Its IUPAC name is 8-(7-fluoro-4-methylquinolin-2-yl)-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(7-fluoro-4-methylquinolin-2-yl)-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 165427398 |
| Molecular Formula | C21H25FN4O2 |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 8-(7-fluoro-4-methylquinolin-2-yl)-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1cc(N2CCC3(CC2)C(=O)NC(=O)N3CC(C)C)nc2cc(F)ccc12 |
| InChI | InChI=1S/C21H25FN4O2/c1-13(2)12-26-20(28)24-19(27)21(26)6-8-25(9-7-21)18-10-14(3)16-5-4-15(22)11-17(16)23-18/h4-5,10-11,13H,6-9,12H2,1-3H3,(H,24,27,28) |
| InChIKey | YXLIFQIXSAVIOS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|