C16H19F3N2O4 — CID 163333876
formic acid;2-methyl-4-[2-[3-(trifluoromethoxy)phenyl]imidazol-1-yl]butan-2-ol (PubChem CID 163333876) has the molecular formula C16H19F3N2O4 and a molecular weight of 360.33 g/mol. Its IUPAC name is formic acid;2-methyl-4-[2-[3-(trifluoromethoxy)phenyl]imidazol-1-yl]butan-2-ol.
| Compound Name | formic acid;2-methyl-4-[2-[3-(trifluoromethoxy)phenyl]imidazol-1-yl]butan-2-ol |
|---|---|
| PubChem CID | 163333876 |
| Molecular Formula | C16H19F3N2O4 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | formic acid;2-methyl-4-[2-[3-(trifluoromethoxy)phenyl]imidazol-1-yl]butan-2-ol |
| SMILES | CC(C)(O)CCn1ccnc1-c1cccc(OC(F)(F)F)c1.O=CO |
| InChI | InChI=1S/C15H17F3N2O2.CH2O2/c1-14(2,21)6-8-20-9-7-19-13(20)11-4-3-5-12(10-11)22-15(16,17)18;2-1-3/h3-5,7,9-10,21H,6,8H2,1-2H3;1H,(H,2,3) |
| InChIKey | YLKWUXAYSROBMZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|