C20H33ClN2O3 — CID 163334370
(1S,3R,4R)-3-amino-N-[3-(3-ethylphenoxy)propyl]-4-methoxy-N-methylcyclohexane-1-carboxamide;hydrochloride (PubChem CID 163334370) has the molecular formula C20H33ClN2O3 and a molecular weight of 384.95 g/mol. Its IUPAC name is (1S,3R,4R)-3-amino-N-[3-(3-ethylphenoxy)propyl]-4-methoxy-N-methylcyclohexane-1-carboxamide;hydrochloride.
| Compound Name | (1S,3R,4R)-3-amino-N-[3-(3-ethylphenoxy)propyl]-4-methoxy-N-methylcyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 163334370 |
| Molecular Formula | C20H33ClN2O3 |
| Molecular Weight | 384.95 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | (1S,3R,4R)-3-amino-N-[3-(3-ethylphenoxy)propyl]-4-methoxy-N-methylcyclohexane-1-carboxamide;hydrochloride |
| SMILES | CCc1cccc(OCCCN(C)C(=O)[C@H]2CC[C@@H](OC)[C@H](N)C2)c1.Cl |
| InChI | InChI=1S/C20H32N2O3.ClH/c1-4-15-7-5-8-17(13-15)25-12-6-11-22(2)20(23)16-9-10-19(24-3)18(21)14-16;/h5,7-8,13,16,18-19H,4,6,9-12,14,21H2,1-3H3;1H/t16-,18+,19+;/m0./s1 |
| InChIKey | METULQKPISLDCM-MBHUSPCXSA-N |
| XLogP | 3.04 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.95 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|