C30H34FN5O6 — CID 163335012
(1R,17S)-20-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetyl]-7-fluoro-11-oxa-3,14,20-triazatricyclo[15.2.1.05,10]icosa-5(10),6,8-triene-4,15-dione;formic acid (PubChem CID 163335012) has the molecular formula C30H34FN5O6 and a molecular weight of 579.63 g/mol. Its IUPAC name is (1R,17S)-20-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetyl]-7-fluoro-11-oxa-3,14,20-triazatricyclo[15.2.1.05,10]icosa-5(10),6,8-triene-4,15-dione;formic acid.
| Compound Name | (1R,17S)-20-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetyl]-7-fluoro-11-oxa-3,14,20-triazatricyclo[15.2.1.05,10]icosa-5(10),6,8-triene-4,15-dione;formic acid |
|---|---|
| PubChem CID | 163335012 |
| Molecular Formula | C30H34FN5O6 |
| Molecular Weight | 579.63 g/mol |
| Exact Mass | 579.25 |
| IUPAC Name | (1R,17S)-20-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetyl]-7-fluoro-11-oxa-3,14,20-triazatricyclo[15.2.1.05,10]icosa-5(10),6,8-triene-4,15-dione;formic acid |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1CC(=O)N1[C@@H]2CC[C@H]1CC(=O)NCCOc1ccc(F)cc1C(=O)NC2.O=CO |
| InChI | InChI=1S/C29H32FN5O4.CH2O2/c1-18-24(19(2)35(33-18)21-6-4-3-5-7-21)16-28(37)34-22-9-10-23(34)17-32-29(38)25-14-20(30)8-11-26(25)39-13-12-31-27(36)15-22;2-1-3/h3-8,11,14,22-23H,9-10,12-13,15-17H2,1-2H3,(H,31,36)(H,32,38);1H,(H,2,3)/t22-,23+;/m0./s1 |
| InChIKey | WHYQRHPGHMTNMM-PEADMDKFSA-N |
| XLogP | 2.56 |
| TPSA | 142.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.63 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|