C22H32FN3O5 — CID 155940141
(1R,17S)-7-fluoro-20-pentyl-11-oxa-3,14,20-triazatricyclo[15.2.1.05,10]icosa-5(10),6,8-triene-4,15-dione;formic acid (PubChem CID 155940141) has the molecular formula C22H32FN3O5 and a molecular weight of 437.51 g/mol. Its IUPAC name is (1R,17S)-7-fluoro-20-pentyl-11-oxa-3,14,20-triazatricyclo[15.2.1.05,10]icosa-5(10),6,8-triene-4,15-dione;formic acid.
| Compound Name | (1R,17S)-7-fluoro-20-pentyl-11-oxa-3,14,20-triazatricyclo[15.2.1.05,10]icosa-5(10),6,8-triene-4,15-dione;formic acid |
|---|---|
| PubChem CID | 155940141 |
| Molecular Formula | C22H32FN3O5 |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | (1R,17S)-7-fluoro-20-pentyl-11-oxa-3,14,20-triazatricyclo[15.2.1.05,10]icosa-5(10),6,8-triene-4,15-dione;formic acid |
| SMILES | CCCCCN1[C@@H]2CC[C@H]1CC(=O)NCCOc1ccc(F)cc1C(=O)NC2.O=CO |
| InChI | InChI=1S/C21H30FN3O3.CH2O2/c1-2-3-4-10-25-16-6-7-17(25)14-24-21(27)18-12-15(22)5-8-19(18)28-11-9-23-20(26)13-16;2-1-3/h5,8,12,16-17H,2-4,6-7,9-11,13-14H2,1H3,(H,23,26)(H,24,27);1H,(H,2,3)/t16-,17+;/m0./s1 |
| InChIKey | OTOWWLFSBUKXBN-MCJVGQIASA-N |
| XLogP | 2.18 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|