C23H24FN5O4 — CID 154563302
5-[(1R,17S)-7-fluoro-4,15-dioxo-11-oxa-3,14,20-triazatricyclo[15.2.1.05,10]icosa-5(10),6,8-triene-20-carbonyl]-1-methylpyrrole-3-carbonitrile (PubChem CID 154563302) has the molecular formula C23H24FN5O4 and a molecular weight of 453.47 g/mol. Its IUPAC name is 5-[(1R,17S)-7-fluoro-4,15-dioxo-11-oxa-3,14,20-triazatricyclo[15.2.1.05,10]icosa-5(10),6,8-triene-20-carbonyl]-1-methylpyrrole-3-carbonitrile.
| Compound Name | 5-[(1R,17S)-7-fluoro-4,15-dioxo-11-oxa-3,14,20-triazatricyclo[15.2.1.05,10]icosa-5(10),6,8-triene-20-carbonyl]-1-methylpyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 154563302 |
| Molecular Formula | C23H24FN5O4 |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 5-[(1R,17S)-7-fluoro-4,15-dioxo-11-oxa-3,14,20-triazatricyclo[15.2.1.05,10]icosa-5(10),6,8-triene-20-carbonyl]-1-methylpyrrole-3-carbonitrile |
| SMILES | Cn1cc(C#N)cc1C(=O)N1[C@@H]2CC[C@H]1CC(=O)NCCOc1ccc(F)cc1C(=O)NC2 |
| InChI | InChI=1S/C23H24FN5O4/c1-28-13-14(11-25)8-19(28)23(32)29-16-3-4-17(29)12-27-22(31)18-9-15(24)2-5-20(18)33-7-6-26-21(30)10-16/h2,5,8-9,13,16-17H,3-4,6-7,10,12H2,1H3,(H,26,30)(H,27,31)/t16-,17+/m0/s1 |
| InChIKey | POLNUUOEMJCKGJ-DLBZAZTESA-N |
| XLogP | 1.34 |
| TPSA | 116.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |