C26H27N5O4S — CID 163336549
N-cyclohexyl-3-[5-[(4-nitrophenyl)methylsulfanyl]-2-oxo-3H-imidazo[1,2-c]quinazolin-3-yl]propanamide (PubChem CID 163336549) has the molecular formula C26H27N5O4S and a molecular weight of 505.60 g/mol. Its IUPAC name is N-cyclohexyl-3-[5-[(4-nitrophenyl)methylsulfanyl]-2-oxo-3H-imidazo[1,2-c]quinazolin-3-yl]propanamide.
| Compound Name | N-cyclohexyl-3-[5-[(4-nitrophenyl)methylsulfanyl]-2-oxo-3H-imidazo[1,2-c]quinazolin-3-yl]propanamide |
|---|---|
| PubChem CID | 163336549 |
| Molecular Formula | C26H27N5O4S |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | N-cyclohexyl-3-[5-[(4-nitrophenyl)methylsulfanyl]-2-oxo-3H-imidazo[1,2-c]quinazolin-3-yl]propanamide |
| SMILES | O=C(CCC1C(=O)N=C2c3ccccc3N=C(SCc3ccc([N+](=O)[O-])cc3)N21)NC1CCCCC1 |
| InChI | InChI=1S/C26H27N5O4S/c32-23(27-18-6-2-1-3-7-18)15-14-22-25(33)29-24-20-8-4-5-9-21(20)28-26(30(22)24)36-16-17-10-12-19(13-11-17)31(34)35/h4-5,8-13,18,22H,1-3,6-7,14-16H2,(H,27,32) |
| InChIKey | SLZRCIJNQZQBDQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 117.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|