C25H21N5O5S — CID 163336569
N-(furan-2-ylmethyl)-3-[5-[(3-nitrophenyl)methylsulfanyl]-2-oxo-3H-imidazo[1,2-c]quinazolin-3-yl]propanamide (PubChem CID 163336569) has the molecular formula C25H21N5O5S and a molecular weight of 503.54 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3-[5-[(3-nitrophenyl)methylsulfanyl]-2-oxo-3H-imidazo[1,2-c]quinazolin-3-yl]propanamide.
| Compound Name | N-(furan-2-ylmethyl)-3-[5-[(3-nitrophenyl)methylsulfanyl]-2-oxo-3H-imidazo[1,2-c]quinazolin-3-yl]propanamide |
|---|---|
| PubChem CID | 163336569 |
| Molecular Formula | C25H21N5O5S |
| Molecular Weight | 503.54 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | N-(furan-2-ylmethyl)-3-[5-[(3-nitrophenyl)methylsulfanyl]-2-oxo-3H-imidazo[1,2-c]quinazolin-3-yl]propanamide |
| SMILES | O=C(CCC1C(=O)N=C2c3ccccc3N=C(SCc3cccc([N+](=O)[O-])c3)N21)NCc1ccco1 |
| InChI | InChI=1S/C25H21N5O5S/c31-22(26-14-18-7-4-12-35-18)11-10-21-24(32)28-23-19-8-1-2-9-20(19)27-25(29(21)23)36-15-16-5-3-6-17(13-16)30(33)34/h1-9,12-13,21H,10-11,14-15H2,(H,26,31) |
| InChIKey | MKSZUSUDVGCKMJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 130.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|