C33H33CaFN2O5 — CID 163336929
calcium (3R,5R)-7-[2-(4-fluorophenyl)-3-(2,3,4,5,6-pentadeuteriophenyl)-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3-hydroxy-5-oxidoheptanoate (PubChem CID 163336929) has the molecular formula C33H33CaFN2O5 and a molecular weight of 601.74 g/mol. Its IUPAC name is calcium (3R,5R)-7-[2-(4-fluorophenyl)-3-(2,3,4,5,6-pentadeuteriophenyl)-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3-hydroxy-5-oxidoheptanoate.
| Compound Name | calcium (3R,5R)-7-[2-(4-fluorophenyl)-3-(2,3,4,5,6-pentadeuteriophenyl)-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3-hydroxy-5-oxidoheptanoate |
|---|---|
| PubChem CID | 163336929 |
| Molecular Formula | C33H33CaFN2O5 |
| Molecular Weight | 601.74 g/mol |
| Exact Mass | 601.23 |
| IUPAC Name | calcium (3R,5R)-7-[2-(4-fluorophenyl)-3-(2,3,4,5,6-pentadeuteriophenyl)-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3-hydroxy-5-oxidoheptanoate |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c(C(=O)Nc3ccccc3)c(C(C)C)n(CC[C@@H]([O-])C[C@@H](O)CC(=O)[O-])c2-c2ccc(F)cc2)c([2H])c1[2H].[Ca+2] |
| InChI | InChI=1S/C33H34FN2O5.Ca/c1-21(2)31-30(33(41)35-25-11-7-4-8-12-25)29(22-9-5-3-6-10-22)32(23-13-15-24(34)16-14-23)36(31)18-17-26(37)19-27(38)20-28(39)40;/h3-16,21,26-27,38H,17-20H2,1-2H3,(H,35,41)(H,39,40);/q-1;+2/p-1/t26-,27-;/m1./s1/i3D,5D,6D,9D,10D; |
| InChIKey | POADFBGNTXEPOQ-ADFDHUHVSA-M |
| XLogP | 3.97 |
| TPSA | 117.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.74 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |