C33H33CaFN2O6 — CID 171700734
calcium (3R,5R)-7-[2-(4-fluorophenyl)-4-[(2-hydroxyphenyl)carbamoyl]-3-(2,3,4,5,6-pentadeuteriophenyl)-5-propan-2-ylpyrrol-1-yl]-3-hydroxy-5-oxidoheptanoate (PubChem CID 171700734) has the molecular formula C33H33CaFN2O6 and a molecular weight of 617.74 g/mol. Its IUPAC name is calcium (3R,5R)-7-[2-(4-fluorophenyl)-4-[(2-hydroxyphenyl)carbamoyl]-3-(2,3,4,5,6-pentadeuteriophenyl)-5-propan-2-ylpyrrol-1-yl]-3-hydroxy-5-oxidoheptanoate.
| Compound Name | calcium (3R,5R)-7-[2-(4-fluorophenyl)-4-[(2-hydroxyphenyl)carbamoyl]-3-(2,3,4,5,6-pentadeuteriophenyl)-5-propan-2-ylpyrrol-1-yl]-3-hydroxy-5-oxidoheptanoate |
|---|---|
| PubChem CID | 171700734 |
| Molecular Formula | C33H33CaFN2O6 |
| Molecular Weight | 617.74 g/mol |
| Exact Mass | 617.23 |
| IUPAC Name | calcium (3R,5R)-7-[2-(4-fluorophenyl)-4-[(2-hydroxyphenyl)carbamoyl]-3-(2,3,4,5,6-pentadeuteriophenyl)-5-propan-2-ylpyrrol-1-yl]-3-hydroxy-5-oxidoheptanoate |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c(C(=O)Nc3ccccc3O)c(C(C)C)n(CC[C@@H]([O-])C[C@@H](O)CC(=O)[O-])c2-c2ccc(F)cc2)c([2H])c1[2H].[Ca+2] |
| InChI | InChI=1S/C33H34FN2O6.Ca/c1-20(2)31-30(33(42)35-26-10-6-7-11-27(26)39)29(21-8-4-3-5-9-21)32(22-12-14-23(34)15-13-22)36(31)17-16-24(37)18-25(38)19-28(40)41;/h3-15,20,24-25,38-39H,16-19H2,1-2H3,(H,35,42)(H,40,41);/q-1;+2/p-1/t24-,25-;/m1./s1/i3D,4D,5D,8D,9D; |
| InChIKey | REFHTOFNVPXNNU-FHADZASJSA-M |
| XLogP | 3.67 |
| TPSA | 137.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.74 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|