C23H33N5O3 — CID 163337333
(1R,9S)-5-(cyclopropylmethyl)-12-[1-(3-methoxypropyl)-2,5-dimethylpyrrole-3-carbonyl]-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodec-6-en-4-one (PubChem CID 163337333) has the molecular formula C23H33N5O3 and a molecular weight of 427.55 g/mol. Its IUPAC name is (1R,9S)-5-(cyclopropylmethyl)-12-[1-(3-methoxypropyl)-2,5-dimethylpyrrole-3-carbonyl]-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodec-6-en-4-one.
| Compound Name | (1R,9S)-5-(cyclopropylmethyl)-12-[1-(3-methoxypropyl)-2,5-dimethylpyrrole-3-carbonyl]-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodec-6-en-4-one |
|---|---|
| PubChem CID | 163337333 |
| Molecular Formula | C23H33N5O3 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | (1R,9S)-5-(cyclopropylmethyl)-12-[1-(3-methoxypropyl)-2,5-dimethylpyrrole-3-carbonyl]-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodec-6-en-4-one |
| SMILES | COCCCn1c(C)cc(C(=O)N2[C@@H]3CC[C@H]2Cc2nn(CC4CC4)c(=O)n2C3)c1C |
| InChI | InChI=1S/C23H33N5O3/c1-15-11-20(16(2)25(15)9-4-10-31-3)22(29)28-18-7-8-19(28)14-26-21(12-18)24-27(23(26)30)13-17-5-6-17/h11,17-19H,4-10,12-14H2,1-3H3/t18-,19+/m0/s1 |
| InChIKey | QTGYZJVIJIHSER-RBUKOAKNSA-N |
| XLogP | 2.14 |
| TPSA | 74.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|