C18H23N5O3 — CID 163337669
(1R,9S)-5-(cyclopropylmethyl)-N-(furan-2-ylmethyl)-4-oxo-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodec-6-ene-12-carboxamide (PubChem CID 163337669) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is (1R,9S)-5-(cyclopropylmethyl)-N-(furan-2-ylmethyl)-4-oxo-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodec-6-ene-12-carboxamide.
| Compound Name | (1R,9S)-5-(cyclopropylmethyl)-N-(furan-2-ylmethyl)-4-oxo-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodec-6-ene-12-carboxamide |
|---|---|
| PubChem CID | 163337669 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | (1R,9S)-5-(cyclopropylmethyl)-N-(furan-2-ylmethyl)-4-oxo-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodec-6-ene-12-carboxamide |
| SMILES | O=C(NCc1ccco1)N1[C@@H]2CC[C@H]1Cc1nn(CC3CC3)c(=O)n1C2 |
| InChI | InChI=1S/C18H23N5O3/c24-17(19-9-15-2-1-7-26-15)23-13-5-6-14(23)11-21-16(8-13)20-22(18(21)25)10-12-3-4-12/h1-2,7,12-14H,3-6,8-11H2,(H,19,24)/t13-,14+/m0/s1 |
| InChIKey | JMIQQXCBUQSIMF-UONOGXRCSA-N |
| XLogP | 1.35 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |