C12H21NO3 — CID 163338223
tert-butyl (2S,4S)-2-(hydroxymethyl)-4-prop-2-enylazetidine-1-carboxylate (PubChem CID 163338223) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is tert-butyl (2S,4S)-2-(hydroxymethyl)-4-prop-2-enylazetidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-2-(hydroxymethyl)-4-prop-2-enylazetidine-1-carboxylate |
|---|---|
| PubChem CID | 163338223 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | tert-butyl (2S,4S)-2-(hydroxymethyl)-4-prop-2-enylazetidine-1-carboxylate |
| SMILES | C=CC[C@H]1C[C@@H](CO)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H21NO3/c1-5-6-9-7-10(8-14)13(9)11(15)16-12(2,3)4/h5,9-10,14H,1,6-8H2,2-4H3/t9-,10-/m0/s1 |
| InChIKey | XXMUXAIUSUYDCI-UWVGGRQHSA-N |
| XLogP | 1.93 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|