C14H7N5O3 — CID 163338883
5-nitro-2-(4-oxo-1,2,3-benzotriazin-3-yl)benzonitrile (PubChem CID 163338883) has the molecular formula C14H7N5O3 and a molecular weight of 293.24 g/mol. Its IUPAC name is 5-nitro-2-(4-oxo-1,2,3-benzotriazin-3-yl)benzonitrile.
| Compound Name | 5-nitro-2-(4-oxo-1,2,3-benzotriazin-3-yl)benzonitrile |
|---|---|
| PubChem CID | 163338883 |
| Molecular Formula | C14H7N5O3 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 5-nitro-2-(4-oxo-1,2,3-benzotriazin-3-yl)benzonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1-n1nnc2ccccc2c1=O |
| InChI | InChI=1S/C14H7N5O3/c15-8-9-7-10(19(21)22)5-6-13(9)18-14(20)11-3-1-2-4-12(11)16-17-18/h1-7H |
| InChIKey | HDLMMILBTBFOIK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 114.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|