C21H10F7N5O5 — CID 53330313
3-fluoro-N-[4-nitro-2-(trifluoromethyl)phenyl]-N-[[4-nitro-2-(trifluoromethyl)phenyl]diazenyl]benzamide (PubChem CID 53330313) has the molecular formula C21H10F7N5O5 and a molecular weight of 545.33 g/mol. Its IUPAC name is 3-fluoro-N-[4-nitro-2-(trifluoromethyl)phenyl]-N-[[4-nitro-2-(trifluoromethyl)phenyl]diazenyl]benzamide.
| Compound Name | 3-fluoro-N-[4-nitro-2-(trifluoromethyl)phenyl]-N-[[4-nitro-2-(trifluoromethyl)phenyl]diazenyl]benzamide |
|---|---|
| PubChem CID | 53330313 |
| Molecular Formula | C21H10F7N5O5 |
| Molecular Weight | 545.33 g/mol |
| Exact Mass | 545.06 |
| IUPAC Name | 3-fluoro-N-[4-nitro-2-(trifluoromethyl)phenyl]-N-[[4-nitro-2-(trifluoromethyl)phenyl]diazenyl]benzamide |
| SMILES | O=C(c1cccc(F)c1)N(/N=N/c1ccc([N+](=O)[O-])cc1C(F)(F)F)c1ccc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C21H10F7N5O5/c22-12-3-1-2-11(8-12)19(34)31(18-7-5-14(33(37)38)10-16(18)21(26,27)28)30-29-17-6-4-13(32(35)36)9-15(17)20(23,24)25/h1-10H/b30-29+ |
| InChIKey | LSRWTRNPTOWKPW-QVIHXGFCSA-N |
| XLogP | 7.03 |
| TPSA | 131.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.33 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|