C17H17N7O3S — CID 163340605
2-[5-(1,3-benzothiazol-7-yl)-1-(2-methylpyrazol-3-yl)-1,2,4-triazol-3-yl]-N-methylacetamide;formic acid (PubChem CID 163340605) has the molecular formula C17H17N7O3S and a molecular weight of 399.44 g/mol. Its IUPAC name is 2-[5-(1,3-benzothiazol-7-yl)-1-(2-methylpyrazol-3-yl)-1,2,4-triazol-3-yl]-N-methylacetamide;formic acid.
| Compound Name | 2-[5-(1,3-benzothiazol-7-yl)-1-(2-methylpyrazol-3-yl)-1,2,4-triazol-3-yl]-N-methylacetamide;formic acid |
|---|---|
| PubChem CID | 163340605 |
| Molecular Formula | C17H17N7O3S |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 2-[5-(1,3-benzothiazol-7-yl)-1-(2-methylpyrazol-3-yl)-1,2,4-triazol-3-yl]-N-methylacetamide;formic acid |
| SMILES | CNC(=O)Cc1nc(-c2cccc3ncsc23)n(-c2ccnn2C)n1.O=CO |
| InChI | InChI=1S/C16H15N7OS.CH2O2/c1-17-13(24)8-12-20-16(23(21-12)14-6-7-19-22(14)2)10-4-3-5-11-15(10)25-9-18-11;2-1-3/h3-7,9H,8H2,1-2H3,(H,17,24);1H,(H,2,3) |
| InChIKey | AWOQJALWGMGSAI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|