C22H21N3O4S3 — CID 163342519
N-(2-methylphenyl)-2-[(3Z)-2-oxo-3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)indol-1-yl]acetamide;methylsulfinylmethane (PubChem CID 163342519) has the molecular formula C22H21N3O4S3 and a molecular weight of 487.63 g/mol. Its IUPAC name is N-(2-methylphenyl)-2-[(3Z)-2-oxo-3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)indol-1-yl]acetamide;methylsulfinylmethane.
| Compound Name | N-(2-methylphenyl)-2-[(3Z)-2-oxo-3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)indol-1-yl]acetamide;methylsulfinylmethane |
|---|---|
| PubChem CID | 163342519 |
| Molecular Formula | C22H21N3O4S3 |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | N-(2-methylphenyl)-2-[(3Z)-2-oxo-3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)indol-1-yl]acetamide;methylsulfinylmethane |
| SMILES | CS(C)=O.Cc1ccccc1NC(=O)CN1C(=O)/C(=C2\SC(=S)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C20H15N3O3S2.C2H6OS/c1-11-6-2-4-8-13(11)21-15(24)10-23-14-9-5-3-7-12(14)16(19(23)26)17-18(25)22-20(27)28-17;1-4(2)3/h2-9H,10H2,1H3,(H,21,24)(H,22,25,27);1-2H3/b17-16-; |
| InChIKey | XDFQEJOOXRJLAV-XYJRJTJESA-N |
| XLogP | 2.83 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|