C20H15BrN4O3S — CID 50741338
2-[(3E)-3-(4-amino-2-oxo-1,3-thiazol-5-ylidene)-5-bromo-2-oxoindol-1-yl]-N-(2-methylphenyl)acetamide (PubChem CID 50741338) has the molecular formula C20H15BrN4O3S and a molecular weight of 471.34 g/mol. Its IUPAC name is 2-[(3E)-3-(4-amino-2-oxo-1,3-thiazol-5-ylidene)-5-bromo-2-oxoindol-1-yl]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[(3E)-3-(4-amino-2-oxo-1,3-thiazol-5-ylidene)-5-bromo-2-oxoindol-1-yl]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 50741338 |
| Molecular Formula | C20H15BrN4O3S |
| Molecular Weight | 471.34 g/mol |
| Exact Mass | 470.00 |
| IUPAC Name | 2-[(3E)-3-(4-amino-2-oxo-1,3-thiazol-5-ylidene)-5-bromo-2-oxoindol-1-yl]-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1NC(=O)CN1C(=O)/C(=C2/SC(=O)N=C2N)c2cc(Br)ccc21 |
| InChI | InChI=1S/C20H15BrN4O3S/c1-10-4-2-3-5-13(10)23-15(26)9-25-14-7-6-11(21)8-12(14)16(19(25)27)17-18(22)24-20(28)29-17/h2-8H,9H2,1H3,(H,23,26)(H2,22,24,28)/b17-16+ |
| InChIKey | RFUGRKDJEGIPHD-WUKNDPDISA-N |
| XLogP | 3.68 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|