C20H13F3N4O3S — CID 50741317
2-[(3E)-3-(2-amino-4-oxo-1,3-thiazol-5-ylidene)-2-oxoindol-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 50741317) has the molecular formula C20H13F3N4O3S and a molecular weight of 446.41 g/mol. Its IUPAC name is 2-[(3E)-3-(2-amino-4-oxo-1,3-thiazol-5-ylidene)-2-oxoindol-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(3E)-3-(2-amino-4-oxo-1,3-thiazol-5-ylidene)-2-oxoindol-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 50741317 |
| Molecular Formula | C20H13F3N4O3S |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 2-[(3E)-3-(2-amino-4-oxo-1,3-thiazol-5-ylidene)-2-oxoindol-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | NC1=NC(=O)/C(=C2\C(=O)N(CC(=O)Nc3ccccc3C(F)(F)F)c3ccccc32)S1 |
| InChI | InChI=1S/C20H13F3N4O3S/c21-20(22,23)11-6-2-3-7-12(11)25-14(28)9-27-13-8-4-1-5-10(13)15(18(27)30)16-17(29)26-19(24)31-16/h1-8H,9H2,(H,25,28)(H2,24,26,29)/b16-15+ |
| InChIKey | OBIOCGXVWIECBT-FOCLMDBBSA-N |
| XLogP | 2.99 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|