C19H13ClN4O3S — CID 50741405
2-[(3E)-3-(2-amino-4-oxo-1,3-thiazol-5-ylidene)-2-oxoindol-1-yl]-N-(4-chlorophenyl)acetamide (PubChem CID 50741405) has the molecular formula C19H13ClN4O3S and a molecular weight of 412.86 g/mol. Its IUPAC name is 2-[(3E)-3-(2-amino-4-oxo-1,3-thiazol-5-ylidene)-2-oxoindol-1-yl]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[(3E)-3-(2-amino-4-oxo-1,3-thiazol-5-ylidene)-2-oxoindol-1-yl]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 50741405 |
| Molecular Formula | C19H13ClN4O3S |
| Molecular Weight | 412.86 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 2-[(3E)-3-(2-amino-4-oxo-1,3-thiazol-5-ylidene)-2-oxoindol-1-yl]-N-(4-chlorophenyl)acetamide |
| SMILES | NC1=NC(=O)/C(=C2\C(=O)N(CC(=O)Nc3ccc(Cl)cc3)c3ccccc32)S1 |
| InChI | InChI=1S/C19H13ClN4O3S/c20-10-5-7-11(8-6-10)22-14(25)9-24-13-4-2-1-3-12(13)15(18(24)27)16-17(26)23-19(21)28-16/h1-8H,9H2,(H,22,25)(H2,21,23,26)/b16-15+ |
| InChIKey | HJTHXPCIISEGGZ-FOCLMDBBSA-N |
| XLogP | 2.62 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.86 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|