C21H13ClN3O5S2- — CID 6034637
2-[(5Z)-5-[1-[2-(3-chloroanilino)-2-oxoethyl]-2-oxoindol-3-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate (PubChem CID 6034637) has the molecular formula C21H13ClN3O5S2- and a molecular weight of 486.94 g/mol. Its IUPAC name is 2-[(5Z)-5-[1-[2-(3-chloroanilino)-2-oxoethyl]-2-oxoindol-3-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate.
| Compound Name | 2-[(5Z)-5-[1-[2-(3-chloroanilino)-2-oxoethyl]-2-oxoindol-3-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 6034637 |
| Molecular Formula | C21H13ClN3O5S2- |
| Molecular Weight | 486.94 g/mol |
| Exact Mass | 486.00 |
| IUPAC Name | 2-[(5Z)-5-[1-[2-(3-chloroanilino)-2-oxoethyl]-2-oxoindol-3-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
| SMILES | O=C([O-])CN1C(=O)/C(=C2/C(=O)N(CC(=O)Nc3cccc(Cl)c3)c3ccccc32)SC1=S |
| InChI | InChI=1S/C21H14ClN3O5S2/c22-11-4-3-5-12(8-11)23-15(26)9-24-14-7-2-1-6-13(14)17(19(24)29)18-20(30)25(10-16(27)28)21(31)32-18/h1-8H,9-10H2,(H,23,26)(H,27,28)/p-1/b18-17- |
| InChIKey | WYRWIZUSWGLKCX-ZCXUNETKSA-M |
| XLogP | 1.65 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.94 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|