C19H13BrN4O5S3 — CID 50741380
2-[(3E)-5-bromo-2-oxo-3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)indol-1-yl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 50741380) has the molecular formula C19H13BrN4O5S3 and a molecular weight of 553.44 g/mol. Its IUPAC name is 2-[(3E)-5-bromo-2-oxo-3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)indol-1-yl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[(3E)-5-bromo-2-oxo-3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)indol-1-yl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 50741380 |
| Molecular Formula | C19H13BrN4O5S3 |
| Molecular Weight | 553.44 g/mol |
| Exact Mass | 551.92 |
| IUPAC Name | 2-[(3E)-5-bromo-2-oxo-3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)indol-1-yl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)CN2C(=O)/C(=C3/SC(=S)NC3=O)c3cc(Br)ccc32)cc1 |
| InChI | InChI=1S/C19H13BrN4O5S3/c20-9-1-6-13-12(7-9)15(16-17(26)23-19(30)31-16)18(27)24(13)8-14(25)22-10-2-4-11(5-3-10)32(21,28)29/h1-7H,8H2,(H,22,25)(H2,21,28,29)(H,23,26,30)/b16-15+ |
| InChIKey | FECTXNSGAHSAHM-FOCLMDBBSA-N |
| XLogP | 1.94 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.44 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|