C13H7BrN2O4S — CID 4737505
5-(1-acetyl-5-bromo-2-oxoindol-3-ylidene)-1,3-thiazolidine-2,4-dione (PubChem CID 4737505) has the molecular formula C13H7BrN2O4S and a molecular weight of 367.18 g/mol. Its IUPAC name is 5-(1-acetyl-5-bromo-2-oxoindol-3-ylidene)-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-(1-acetyl-5-bromo-2-oxoindol-3-ylidene)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 4737505 |
| Molecular Formula | C13H7BrN2O4S |
| Molecular Weight | 367.18 g/mol |
| Exact Mass | 365.93 |
| IUPAC Name | 5-(1-acetyl-5-bromo-2-oxoindol-3-ylidene)-1,3-thiazolidine-2,4-dione |
| SMILES | CC(=O)N1C(=O)C(=C2SC(=O)NC2=O)c2cc(Br)ccc21 |
| InChI | InChI=1S/C13H7BrN2O4S/c1-5(17)16-8-3-2-6(14)4-7(8)9(12(16)19)10-11(18)15-13(20)21-10/h2-4H,1H3,(H,15,18,20) |
| InChIKey | BLOWYRARCAXHLG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.18 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|