C19H13BrClN3O2S — CID 135708587
(5Z)-5-(5-bromo-1-methyl-2-oxoindol-3-ylidene)-2-(4-chloro-2-methylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135708587) has the molecular formula C19H13BrClN3O2S and a molecular weight of 462.76 g/mol. Its IUPAC name is (5Z)-5-(5-bromo-1-methyl-2-oxoindol-3-ylidene)-2-(4-chloro-2-methylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-(5-bromo-1-methyl-2-oxoindol-3-ylidene)-2-(4-chloro-2-methylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135708587 |
| Molecular Formula | C19H13BrClN3O2S |
| Molecular Weight | 462.76 g/mol |
| Exact Mass | 460.96 |
| IUPAC Name | (5Z)-5-(5-bromo-1-methyl-2-oxoindol-3-ylidene)-2-(4-chloro-2-methylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(Cl)ccc1/N=C1/NC(=O)/C(=C2/C(=O)N(C)c3ccc(Br)cc32)S1 |
| InChI | InChI=1S/C19H13BrClN3O2S/c1-9-7-11(21)4-5-13(9)22-19-23-17(25)16(27-19)15-12-8-10(20)3-6-14(12)24(2)18(15)26/h3-8H,1-2H3,(H,22,23,25)/b16-15- |
| InChIKey | DBTDNJZGDKBRBJ-NXVVXOECSA-N |
| XLogP | 4.65 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.76 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|