C19H11Cl2N3O3S — CID 135486639
5-(1-acetyl-2-oxoindol-3-ylidene)-2-(2,3-dichlorophenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135486639) has the molecular formula C19H11Cl2N3O3S and a molecular weight of 432.29 g/mol. Its IUPAC name is 5-(1-acetyl-2-oxoindol-3-ylidene)-2-(2,3-dichlorophenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-(1-acetyl-2-oxoindol-3-ylidene)-2-(2,3-dichlorophenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135486639 |
| Molecular Formula | C19H11Cl2N3O3S |
| Molecular Weight | 432.29 g/mol |
| Exact Mass | 430.99 |
| IUPAC Name | 5-(1-acetyl-2-oxoindol-3-ylidene)-2-(2,3-dichlorophenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CC(=O)N1C(=O)C(=C2S/C(=N/c3cccc(Cl)c3Cl)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C19H11Cl2N3O3S/c1-9(25)24-13-8-3-2-5-10(13)14(18(24)27)16-17(26)23-19(28-16)22-12-7-4-6-11(20)15(12)21/h2-8H,1H3,(H,22,23,26) |
| InChIKey | JJPZVEVCMGRANV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.29 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|