C19H14Cl2N2OS — CID 135539299
(5E)-2-(2,3-dichlorophenyl)imino-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-1,3-thiazolidin-4-one (PubChem CID 135539299) has the molecular formula C19H14Cl2N2OS and a molecular weight of 389.31 g/mol. Its IUPAC name is (5E)-2-(2,3-dichlorophenyl)imino-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(2,3-dichlorophenyl)imino-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135539299 |
| Molecular Formula | C19H14Cl2N2OS |
| Molecular Weight | 389.31 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | (5E)-2-(2,3-dichlorophenyl)imino-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-1,3-thiazolidin-4-one |
| SMILES | CC(=C\c1ccccc1)/C=C1/S/C(=N/c2cccc(Cl)c2Cl)NC1=O |
| InChI | InChI=1S/C19H14Cl2N2OS/c1-12(10-13-6-3-2-4-7-13)11-16-18(24)23-19(25-16)22-15-9-5-8-14(20)17(15)21/h2-11H,1H3,(H,22,23,24)/b12-10+,16-11+ |
| InChIKey | TZMNEYHQUPRDSV-SKZWUVKFSA-N |
| XLogP | 5.83 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.31 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|