C20H18N2OS — CID 135518502
(5Z)-2-(2-methylphenyl)imino-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-1,3-thiazolidin-4-one (PubChem CID 135518502) has the molecular formula C20H18N2OS and a molecular weight of 334.44 g/mol. Its IUPAC name is (5Z)-2-(2-methylphenyl)imino-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(2-methylphenyl)imino-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135518502 |
| Molecular Formula | C20H18N2OS |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | (5Z)-2-(2-methylphenyl)imino-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-1,3-thiazolidin-4-one |
| SMILES | CC(/C=C1\S/C(=N/c2ccccc2C)NC1=O)=C\c1ccccc1 |
| InChI | InChI=1S/C20H18N2OS/c1-14(12-16-9-4-3-5-10-16)13-18-19(23)22-20(24-18)21-17-11-7-6-8-15(17)2/h3-13H,1-2H3,(H,21,22,23)/b14-12+,18-13- |
| InChIKey | QCNACJOIUMGCHX-COVZNBLNSA-N |
| XLogP | 4.83 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|