About 4-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-6-ethyl-2-methylsulfanylpyrimidine
4-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-6-ethyl-2-methylsulfanylpyrimidine (PubChem CID 163343966) has the molecular formula C17H24N6S
and a molecular weight of 344.49 g/mol. Its IUPAC name is 4-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-6-ethyl-2-methylsulfanylpyrimidine.
Molecular Properties
| Compound Name | 4-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-6-ethyl-2-methylsulfanylpyrimidine |
| PubChem CID | 163343966 |
| Molecular Formula | C17H24N6S |
| Molecular Weight | 344.49 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 4-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-6-ethyl-2-methylsulfanylpyrimidine |
| SMILES | CCc1cc(N2CCN(c3ncnc(C)c3C)CC2)nc(SC)n1 |
| InChI | InChI=1S/C17H24N6S/c1-5-14-10-15(21-17(20-14)24-4)22-6-8-23(9-7-22)16-12(2)13(3)18-11-19-16/h10-11H,5-9H2,1-4H3 |
| InChIKey | CYLRLVPODBTSRU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-6-ethyl-2-methylsulfanylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-6-ethyl-2-methylsulfanylpyrimidine?
The IUPAC name of 4-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-6-ethyl-2-methylsulfanylpyrimidine (CID 163343966) is 4-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-6-ethyl-2-methylsulfanylpyrimidine.
What is the SMILES notation for 4-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-6-ethyl-2-methylsulfanylpyrimidine?
The canonical SMILES for 4-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-6-ethyl-2-methylsulfanylpyrimidine is CCc1cc(N2CCN(c3ncnc(C)c3C)CC2)nc(SC)n1.
What is the InChIKey of 4-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-6-ethyl-2-methylsulfanylpyrimidine?
The InChIKey is CYLRLVPODBTSRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N6S/c1-5-14-10-15(21-17(20-14)24-4)22-6-8-23(9-7-22)16-12(2)13(3)18-11-19-16/h10-11H,5-9H2,1-4H3.
What are the key properties of 4-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-6-ethyl-2-methylsulfanylpyrimidine?
4-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-6-ethyl-2-methylsulfanylpyrimidine has a molecular weight of 344.49 g/mol, XLogP of 2.49, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]-6-ethyl-2-methylsulfanylpyrimidine is sourced from PubChem (CID 163343966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).