About 6-[4-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)piperazin-1-yl]-7-methylpurine
6-[4-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)piperazin-1-yl]-7-methylpurine (PubChem CID 163344430) has the molecular formula C17H22N8S
and a molecular weight of 370.49 g/mol. Its IUPAC name is 6-[4-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)piperazin-1-yl]-7-methylpurine.
Molecular Properties
| Compound Name | 6-[4-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)piperazin-1-yl]-7-methylpurine |
| PubChem CID | 163344430 |
| Molecular Formula | C17H22N8S |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 6-[4-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)piperazin-1-yl]-7-methylpurine |
| SMILES | CSc1nc(C)c(C)c(N2CCN(c3ncnc4ncn(C)c34)CC2)n1 |
| InChI | InChI=1S/C17H22N8S/c1-11-12(2)21-17(26-4)22-15(11)24-5-7-25(8-6-24)16-13-14(18-9-19-16)20-10-23(13)3/h9-10H,5-8H2,1-4H3 |
| InChIKey | OUYKGLOGEBAHGK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 75.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 6-[4-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)piperazin-1-yl]-7-methylpurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)piperazin-1-yl]-7-methylpurine?
The IUPAC name of 6-[4-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)piperazin-1-yl]-7-methylpurine (CID 163344430) is 6-[4-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)piperazin-1-yl]-7-methylpurine.
What is the SMILES notation for 6-[4-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)piperazin-1-yl]-7-methylpurine?
The canonical SMILES for 6-[4-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)piperazin-1-yl]-7-methylpurine is CSc1nc(C)c(C)c(N2CCN(c3ncnc4ncn(C)c34)CC2)n1.
What is the InChIKey of 6-[4-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)piperazin-1-yl]-7-methylpurine?
The InChIKey is OUYKGLOGEBAHGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N8S/c1-11-12(2)21-17(26-4)22-15(11)24-5-7-25(8-6-24)16-13-14(18-9-19-16)20-10-23(13)3/h9-10H,5-8H2,1-4H3.
What are the key properties of 6-[4-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)piperazin-1-yl]-7-methylpurine?
6-[4-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)piperazin-1-yl]-7-methylpurine has a molecular weight of 370.49 g/mol, XLogP of 1.82, 3 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)piperazin-1-yl]-7-methylpurine is sourced from PubChem (CID 163344430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).