C20H23ClN8O — CID 10320294
[5-chloro-6-[4-(7-methylpurin-6-yl)piperazin-1-yl]-3-pyridinyl]-pyrrolidin-1-ylmethanone (PubChem CID 10320294) has the molecular formula C20H23ClN8O and a molecular weight of 426.91 g/mol. Its IUPAC name is [5-chloro-6-[4-(7-methylpurin-6-yl)piperazin-1-yl]-3-pyridinyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [5-chloro-6-[4-(7-methylpurin-6-yl)piperazin-1-yl]-3-pyridinyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 10320294 |
| Molecular Formula | C20H23ClN8O |
| Molecular Weight | 426.91 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | [5-chloro-6-[4-(7-methylpurin-6-yl)piperazin-1-yl]-3-pyridinyl]-pyrrolidin-1-ylmethanone |
| SMILES | Cn1cnc2ncnc(N3CCN(c4ncc(C(=O)N5CCCC5)cc4Cl)CC3)c21 |
| InChI | InChI=1S/C20H23ClN8O/c1-26-13-25-17-16(26)19(24-12-23-17)28-8-6-27(7-9-28)18-15(21)10-14(11-22-18)20(30)29-4-2-3-5-29/h10-13H,2-9H2,1H3 |
| InChIKey | DPILYUVHAJIPNT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 83.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.91 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |