C19H24ClN3O — CID 133322869
[6-(1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-5-chloro-3-pyridinyl]-piperidin-1-ylmethanone (PubChem CID 133322869) has the molecular formula C19H24ClN3O and a molecular weight of 345.87 g/mol. Its IUPAC name is [6-(1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-5-chloro-3-pyridinyl]-piperidin-1-ylmethanone.
| Compound Name | [6-(1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-5-chloro-3-pyridinyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 133322869 |
| Molecular Formula | C19H24ClN3O |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | [6-(1,3,3a,4,7,7a-hexahydroisoindol-2-yl)-5-chloro-3-pyridinyl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1cnc(N2CC3CC=CCC3C2)c(Cl)c1)N1CCCCC1 |
| InChI | InChI=1S/C19H24ClN3O/c20-17-10-16(19(24)22-8-4-1-5-9-22)11-21-18(17)23-12-14-6-2-3-7-15(14)13-23/h2-3,10-11,14-15H,1,4-9,12-13H2 |
| InChIKey | VQNAQSWMMKAFEH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|