C20H29ClN4O — CID 133270898
[5-chloro-6-(4-cyclopentylpiperazin-1-yl)-3-pyridinyl]-piperidin-1-ylmethanone (PubChem CID 133270898) has the molecular formula C20H29ClN4O and a molecular weight of 376.93 g/mol. Its IUPAC name is [5-chloro-6-(4-cyclopentylpiperazin-1-yl)-3-pyridinyl]-piperidin-1-ylmethanone.
| Compound Name | [5-chloro-6-(4-cyclopentylpiperazin-1-yl)-3-pyridinyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 133270898 |
| Molecular Formula | C20H29ClN4O |
| Molecular Weight | 376.93 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | [5-chloro-6-(4-cyclopentylpiperazin-1-yl)-3-pyridinyl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1cnc(N2CCN(C3CCCC3)CC2)c(Cl)c1)N1CCCCC1 |
| InChI | InChI=1S/C20H29ClN4O/c21-18-14-16(20(26)25-8-4-1-5-9-25)15-22-19(18)24-12-10-23(11-13-24)17-6-2-3-7-17/h14-15,17H,1-13H2 |
| InChIKey | NZIJXLQQEPNXHC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.93 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |