C20H29ClN4O2 — CID 133335857
[5-chloro-6-[4-(oxolan-3-ylmethyl)piperazin-1-yl]-3-pyridinyl]-piperidin-1-ylmethanone (PubChem CID 133335857) has the molecular formula C20H29ClN4O2 and a molecular weight of 392.93 g/mol. Its IUPAC name is [5-chloro-6-[4-(oxolan-3-ylmethyl)piperazin-1-yl]-3-pyridinyl]-piperidin-1-ylmethanone.
| Compound Name | [5-chloro-6-[4-(oxolan-3-ylmethyl)piperazin-1-yl]-3-pyridinyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 133335857 |
| Molecular Formula | C20H29ClN4O2 |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | [5-chloro-6-[4-(oxolan-3-ylmethyl)piperazin-1-yl]-3-pyridinyl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1cnc(N2CCN(CC3CCOC3)CC2)c(Cl)c1)N1CCCCC1 |
| InChI | InChI=1S/C20H29ClN4O2/c21-18-12-17(20(26)25-5-2-1-3-6-25)13-22-19(18)24-9-7-23(8-10-24)14-16-4-11-27-15-16/h12-13,16H,1-11,14-15H2 |
| InChIKey | UMULDWUYFWSETI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |