C17H19N5O2 — CID 163344652
N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-N,5,6-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 163344652) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-N,5,6-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-N,5,6-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 163344652 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-N,5,6-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Cc1nc2ncnn2c(N(C)Cc2ccc3c(c2)OCCO3)c1C |
| InChI | InChI=1S/C17H19N5O2/c1-11-12(2)20-17-18-10-19-22(17)16(11)21(3)9-13-4-5-14-15(8-13)24-7-6-23-14/h4-5,8,10H,6-7,9H2,1-3H3 |
| InChIKey | KGSKWFRYMWDYBS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 64.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |