C17H21N3O3S — CID 163345188
N-(3-methoxyphenyl)-2-[4-(1,3-thiazol-2-yloxy)piperidin-1-yl]acetamide (PubChem CID 163345188) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-2-[4-(1,3-thiazol-2-yloxy)piperidin-1-yl]acetamide.
| Compound Name | N-(3-methoxyphenyl)-2-[4-(1,3-thiazol-2-yloxy)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 163345188 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-(3-methoxyphenyl)-2-[4-(1,3-thiazol-2-yloxy)piperidin-1-yl]acetamide |
| SMILES | COc1cccc(NC(=O)CN2CCC(Oc3nccs3)CC2)c1 |
| InChI | InChI=1S/C17H21N3O3S/c1-22-15-4-2-3-13(11-15)19-16(21)12-20-8-5-14(6-9-20)23-17-18-7-10-24-17/h2-4,7,10-11,14H,5-6,8-9,12H2,1H3,(H,19,21) |
| InChIKey | AYBPDRVVKKASMO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |