C16H20ClN5 — CID 163345578
5-chloro-N-methyl-N-[1-(6-methyl-2-pyridinyl)piperidin-4-yl]pyrimidin-2-amine (PubChem CID 163345578) has the molecular formula C16H20ClN5 and a molecular weight of 317.82 g/mol. Its IUPAC name is 5-chloro-N-methyl-N-[1-(6-methyl-2-pyridinyl)piperidin-4-yl]pyrimidin-2-amine.
| Compound Name | 5-chloro-N-methyl-N-[1-(6-methyl-2-pyridinyl)piperidin-4-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 163345578 |
| Molecular Formula | C16H20ClN5 |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 5-chloro-N-methyl-N-[1-(6-methyl-2-pyridinyl)piperidin-4-yl]pyrimidin-2-amine |
| SMILES | Cc1cccc(N2CCC(N(C)c3ncc(Cl)cn3)CC2)n1 |
| InChI | InChI=1S/C16H20ClN5/c1-12-4-3-5-15(20-12)22-8-6-14(7-9-22)21(2)16-18-10-13(17)11-19-16/h3-5,10-11,14H,6-9H2,1-2H3 |
| InChIKey | JBNQUNNHLNAYQB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |