About 4-[[4-[(3,5-difluorophenyl)methyl]-3-methylpiperazin-1-yl]methyl]-2-methyl-1,3-oxazole
4-[[4-[(3,5-difluorophenyl)methyl]-3-methylpiperazin-1-yl]methyl]-2-methyl-1,3-oxazole (PubChem CID 163350274) has the molecular formula C17H21F2N3O
and a molecular weight of 321.37 g/mol. Its IUPAC name is 4-[[4-[(3,5-difluorophenyl)methyl]-3-methylpiperazin-1-yl]methyl]-2-methyl-1,3-oxazole.
Molecular Properties
| Compound Name | 4-[[4-[(3,5-difluorophenyl)methyl]-3-methylpiperazin-1-yl]methyl]-2-methyl-1,3-oxazole |
| PubChem CID | 163350274 |
| Molecular Formula | C17H21F2N3O |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 4-[[4-[(3,5-difluorophenyl)methyl]-3-methylpiperazin-1-yl]methyl]-2-methyl-1,3-oxazole |
| SMILES | Cc1nc(CN2CCN(Cc3cc(F)cc(F)c3)C(C)C2)co1 |
| InChI | InChI=1S/C17H21F2N3O/c1-12-8-21(10-17-11-23-13(2)20-17)3-4-22(12)9-14-5-15(18)7-16(19)6-14/h5-7,11-12H,3-4,8-10H2,1-2H3 |
| InChIKey | ZNMJYGWKAIJRRU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[4-[(3,5-difluorophenyl)methyl]-3-methylpiperazin-1-yl]methyl]-2-methyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-[(3,5-difluorophenyl)methyl]-3-methylpiperazin-1-yl]methyl]-2-methyl-1,3-oxazole?
The IUPAC name of 4-[[4-[(3,5-difluorophenyl)methyl]-3-methylpiperazin-1-yl]methyl]-2-methyl-1,3-oxazole (CID 163350274) is 4-[[4-[(3,5-difluorophenyl)methyl]-3-methylpiperazin-1-yl]methyl]-2-methyl-1,3-oxazole.
What is the SMILES notation for 4-[[4-[(3,5-difluorophenyl)methyl]-3-methylpiperazin-1-yl]methyl]-2-methyl-1,3-oxazole?
The canonical SMILES for 4-[[4-[(3,5-difluorophenyl)methyl]-3-methylpiperazin-1-yl]methyl]-2-methyl-1,3-oxazole is Cc1nc(CN2CCN(Cc3cc(F)cc(F)c3)C(C)C2)co1.
What is the InChIKey of 4-[[4-[(3,5-difluorophenyl)methyl]-3-methylpiperazin-1-yl]methyl]-2-methyl-1,3-oxazole?
The InChIKey is ZNMJYGWKAIJRRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21F2N3O/c1-12-8-21(10-17-11-23-13(2)20-17)3-4-22(12)9-14-5-15(18)7-16(19)6-14/h5-7,11-12H,3-4,8-10H2,1-2H3.
What are the key properties of 4-[[4-[(3,5-difluorophenyl)methyl]-3-methylpiperazin-1-yl]methyl]-2-methyl-1,3-oxazole?
4-[[4-[(3,5-difluorophenyl)methyl]-3-methylpiperazin-1-yl]methyl]-2-methyl-1,3-oxazole has a molecular weight of 321.37 g/mol, XLogP of 2.97, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-[(3,5-difluorophenyl)methyl]-3-methylpiperazin-1-yl]methyl]-2-methyl-1,3-oxazole is sourced from PubChem (CID 163350274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).