C15H13FN4OS — CID 163355218
7-(3-fluorophenyl)-3-(2-methylprop-2-enylsulfanyl)-[1,2,4]triazolo[4,3-a]pyrazin-8-one (PubChem CID 163355218) has the molecular formula C15H13FN4OS and a molecular weight of 316.36 g/mol. Its IUPAC name is 7-(3-fluorophenyl)-3-(2-methylprop-2-enylsulfanyl)-[1,2,4]triazolo[4,3-a]pyrazin-8-one.
| Compound Name | 7-(3-fluorophenyl)-3-(2-methylprop-2-enylsulfanyl)-[1,2,4]triazolo[4,3-a]pyrazin-8-one |
|---|---|
| PubChem CID | 163355218 |
| Molecular Formula | C15H13FN4OS |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 7-(3-fluorophenyl)-3-(2-methylprop-2-enylsulfanyl)-[1,2,4]triazolo[4,3-a]pyrazin-8-one |
| SMILES | C=C(C)CSc1nnc2c(=O)n(-c3cccc(F)c3)ccn12 |
| InChI | InChI=1S/C15H13FN4OS/c1-10(2)9-22-15-18-17-13-14(21)19(6-7-20(13)15)12-5-3-4-11(16)8-12/h3-8H,1,9H2,2H3 |
| InChIKey | FVTVIOXQZJELLM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|