C14H9FN4OS — CID 163355243
7-(3-fluorophenyl)-3-prop-2-ynylsulfanyl-[1,2,4]triazolo[4,3-a]pyrazin-8-one (PubChem CID 163355243) has the molecular formula C14H9FN4OS and a molecular weight of 300.32 g/mol. Its IUPAC name is 7-(3-fluorophenyl)-3-prop-2-ynylsulfanyl-[1,2,4]triazolo[4,3-a]pyrazin-8-one.
| Compound Name | 7-(3-fluorophenyl)-3-prop-2-ynylsulfanyl-[1,2,4]triazolo[4,3-a]pyrazin-8-one |
|---|---|
| PubChem CID | 163355243 |
| Molecular Formula | C14H9FN4OS |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 7-(3-fluorophenyl)-3-prop-2-ynylsulfanyl-[1,2,4]triazolo[4,3-a]pyrazin-8-one |
| SMILES | C#CCSc1nnc2c(=O)n(-c3cccc(F)c3)ccn12 |
| InChI | InChI=1S/C14H9FN4OS/c1-2-8-21-14-17-16-12-13(20)18(6-7-19(12)14)11-5-3-4-10(15)9-11/h1,3-7,9H,8H2 |
| InChIKey | SZCONIVCWGBWDS-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|