C16H14N4OS — CID 163358424
7-(3,4-dimethylphenyl)-3-prop-2-ynylsulfanyl-[1,2,4]triazolo[4,3-a]pyrazin-8-one (PubChem CID 163358424) has the molecular formula C16H14N4OS and a molecular weight of 310.38 g/mol. Its IUPAC name is 7-(3,4-dimethylphenyl)-3-prop-2-ynylsulfanyl-[1,2,4]triazolo[4,3-a]pyrazin-8-one.
| Compound Name | 7-(3,4-dimethylphenyl)-3-prop-2-ynylsulfanyl-[1,2,4]triazolo[4,3-a]pyrazin-8-one |
|---|---|
| PubChem CID | 163358424 |
| Molecular Formula | C16H14N4OS |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 7-(3,4-dimethylphenyl)-3-prop-2-ynylsulfanyl-[1,2,4]triazolo[4,3-a]pyrazin-8-one |
| SMILES | C#CCSc1nnc2c(=O)n(-c3ccc(C)c(C)c3)ccn12 |
| InChI | InChI=1S/C16H14N4OS/c1-4-9-22-16-18-17-14-15(21)19(7-8-20(14)16)13-6-5-11(2)12(3)10-13/h1,5-8,10H,9H2,2-3H3 |
| InChIKey | KPRULBVVSHODRI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|