C19H18F2N2O2 — CID 163358366
N-(2-fluorophenyl)-1-[(4-fluorophenyl)methyl]-6-oxopiperidine-2-carboxamide (PubChem CID 163358366) has the molecular formula C19H18F2N2O2 and a molecular weight of 344.36 g/mol. Its IUPAC name is N-(2-fluorophenyl)-1-[(4-fluorophenyl)methyl]-6-oxopiperidine-2-carboxamide.
| Compound Name | N-(2-fluorophenyl)-1-[(4-fluorophenyl)methyl]-6-oxopiperidine-2-carboxamide |
|---|---|
| PubChem CID | 163358366 |
| Molecular Formula | C19H18F2N2O2 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N-(2-fluorophenyl)-1-[(4-fluorophenyl)methyl]-6-oxopiperidine-2-carboxamide |
| SMILES | O=C(Nc1ccccc1F)C1CCCC(=O)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C19H18F2N2O2/c20-14-10-8-13(9-11-14)12-23-17(6-3-7-18(23)24)19(25)22-16-5-2-1-4-15(16)21/h1-2,4-5,8-11,17H,3,6-7,12H2,(H,22,25) |
| InChIKey | XVWOIAAPPJCMOY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |