C23H28O4S — CID 163359644
[(E)-1-(benzenesulfonyl)dec-2-en-5-yl] benzoate (PubChem CID 163359644) has the molecular formula C23H28O4S and a molecular weight of 400.54 g/mol. Its IUPAC name is [(E)-1-(benzenesulfonyl)dec-2-en-5-yl] benzoate.
| Compound Name | [(E)-1-(benzenesulfonyl)dec-2-en-5-yl] benzoate |
|---|---|
| PubChem CID | 163359644 |
| Molecular Formula | C23H28O4S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | [(E)-1-(benzenesulfonyl)dec-2-en-5-yl] benzoate |
| SMILES | CCCCCC(C/C=C/CS(=O)(=O)c1ccccc1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H28O4S/c1-2-3-6-15-21(27-23(24)20-13-7-4-8-14-20)16-11-12-19-28(25,26)22-17-9-5-10-18-22/h4-5,7-14,17-18,21H,2-3,6,15-16,19H2,1H3/b12-11+ |
| InChIKey | ZPCBQPLSWAIFJC-VAWYXSNFSA-N |
| XLogP | 5.21 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|