C24H28O4S — CID 163359648
[(E)-5-(benzenesulfonyl)-1-cyclohexylpent-3-enyl] benzoate (PubChem CID 163359648) has the molecular formula C24H28O4S and a molecular weight of 412.55 g/mol. Its IUPAC name is [(E)-5-(benzenesulfonyl)-1-cyclohexylpent-3-enyl] benzoate.
| Compound Name | [(E)-5-(benzenesulfonyl)-1-cyclohexylpent-3-enyl] benzoate |
|---|---|
| PubChem CID | 163359648 |
| Molecular Formula | C24H28O4S |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | [(E)-5-(benzenesulfonyl)-1-cyclohexylpent-3-enyl] benzoate |
| SMILES | O=C(OC(C/C=C/CS(=O)(=O)c1ccccc1)C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C24H28O4S/c25-24(21-14-6-2-7-15-21)28-23(20-12-4-1-5-13-20)18-10-11-19-29(26,27)22-16-8-3-9-17-22/h2-3,6-11,14-17,20,23H,1,4-5,12-13,18-19H2/b11-10+ |
| InChIKey | CTHNOJOADQAUQR-ZHACJKMWSA-N |
| XLogP | 5.21 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|