C23H35NO2 — CID 163359738
[(E)-1-(2-methylpiperidin-1-yl)dec-2-en-5-yl] benzoate (PubChem CID 163359738) has the molecular formula C23H35NO2 and a molecular weight of 357.54 g/mol. Its IUPAC name is [(E)-1-(2-methylpiperidin-1-yl)dec-2-en-5-yl] benzoate.
| Compound Name | [(E)-1-(2-methylpiperidin-1-yl)dec-2-en-5-yl] benzoate |
|---|---|
| PubChem CID | 163359738 |
| Molecular Formula | C23H35NO2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | [(E)-1-(2-methylpiperidin-1-yl)dec-2-en-5-yl] benzoate |
| SMILES | CCCCCC(C/C=C/CN1CCCCC1C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H35NO2/c1-3-4-6-16-22(26-23(25)21-14-7-5-8-15-21)17-10-12-19-24-18-11-9-13-20(24)2/h5,7-8,10,12,14-15,20,22H,3-4,6,9,11,13,16-19H2,1-2H3/b12-10+ |
| InChIKey | NKYALYZNFBKBOP-ZRDIBKRKSA-N |
| XLogP | 5.61 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|