C18H27Cl5OSn — CID 163360610
diethyl-octyl-(2,3,4,5,6-pentachlorophenoxy)stannane (PubChem CID 163360610) has the molecular formula C18H27Cl5OSn and a molecular weight of 555.39 g/mol. Its IUPAC name is diethyl-octyl-(2,3,4,5,6-pentachlorophenoxy)stannane.
| Compound Name | diethyl-octyl-(2,3,4,5,6-pentachlorophenoxy)stannane |
|---|---|
| PubChem CID | 163360610 |
| Molecular Formula | C18H27Cl5OSn |
| Molecular Weight | 555.39 g/mol |
| Exact Mass | 553.95 |
| IUPAC Name | diethyl-octyl-(2,3,4,5,6-pentachlorophenoxy)stannane |
| SMILES | CCCCCCCC[Sn](CC)(CC)Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C8H17.C6HCl5O.2C2H5.Sn/c1-3-5-7-8-6-4-2;7-1-2(8)4(10)6(12)5(11)3(1)9;2*1-2;/h1,3-8H2,2H3;12H;2*1H2,2H3;/q;;;;+1/p-1 |
| InChIKey | SPAQUOFUGHXYJW-UHFFFAOYSA-M |
| XLogP | 9.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.39 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|