C21H13F5N2O4 — CID 163361391
2-(4-fluoro-2-methylphenoxy)-N-(4-fluoro-3-nitrophenyl)-4-(trifluoromethyl)benzamide (PubChem CID 163361391) has the molecular formula C21H13F5N2O4 and a molecular weight of 452.34 g/mol. Its IUPAC name is 2-(4-fluoro-2-methylphenoxy)-N-(4-fluoro-3-nitrophenyl)-4-(trifluoromethyl)benzamide.
| Compound Name | 2-(4-fluoro-2-methylphenoxy)-N-(4-fluoro-3-nitrophenyl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 163361391 |
| Molecular Formula | C21H13F5N2O4 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | 2-(4-fluoro-2-methylphenoxy)-N-(4-fluoro-3-nitrophenyl)-4-(trifluoromethyl)benzamide |
| SMILES | Cc1cc(F)ccc1Oc1cc(C(F)(F)F)ccc1C(=O)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H13F5N2O4/c1-11-8-13(22)3-7-18(11)32-19-9-12(21(24,25)26)2-5-15(19)20(29)27-14-4-6-16(23)17(10-14)28(30)31/h2-10H,1H3,(H,27,29) |
| InChIKey | ZKRJQWBZUKZXPG-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|