C23H19F5N4O3 — CID 163361418
N-[3-[(diaminomethylideneamino)oxymethyl]-4-fluorophenyl]-2-(4-fluoro-2-methylphenoxy)-5-(trifluoromethyl)benzamide (PubChem CID 163361418) has the molecular formula C23H19F5N4O3 and a molecular weight of 494.42 g/mol. Its IUPAC name is N-[3-[(diaminomethylideneamino)oxymethyl]-4-fluorophenyl]-2-(4-fluoro-2-methylphenoxy)-5-(trifluoromethyl)benzamide.
| Compound Name | N-[3-[(diaminomethylideneamino)oxymethyl]-4-fluorophenyl]-2-(4-fluoro-2-methylphenoxy)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 163361418 |
| Molecular Formula | C23H19F5N4O3 |
| Molecular Weight | 494.42 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | N-[3-[(diaminomethylideneamino)oxymethyl]-4-fluorophenyl]-2-(4-fluoro-2-methylphenoxy)-5-(trifluoromethyl)benzamide |
| SMILES | Cc1cc(F)ccc1Oc1ccc(C(F)(F)F)cc1C(=O)Nc1ccc(F)c(CON=C(N)N)c1 |
| InChI | InChI=1S/C23H19F5N4O3/c1-12-8-15(24)3-7-19(12)35-20-6-2-14(23(26,27)28)10-17(20)21(33)31-16-4-5-18(25)13(9-16)11-34-32-22(29)30/h2-10H,11H2,1H3,(H,31,33)(H4,29,30,32) |
| InChIKey | SHXPVSHPZVFHLU-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.42 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|