C26H19F5N4O3 — CID 163361330
N-[3-(diaminomethylidenecarbamoyl)-4-fluorophenyl]-2-(4-fluoro-2-methylphenoxy)-5-prop-1-ynyl-4-(trifluoromethyl)benzamide (PubChem CID 163361330) has the molecular formula C26H19F5N4O3 and a molecular weight of 530.45 g/mol. Its IUPAC name is N-[3-(diaminomethylidenecarbamoyl)-4-fluorophenyl]-2-(4-fluoro-2-methylphenoxy)-5-prop-1-ynyl-4-(trifluoromethyl)benzamide.
| Compound Name | N-[3-(diaminomethylidenecarbamoyl)-4-fluorophenyl]-2-(4-fluoro-2-methylphenoxy)-5-prop-1-ynyl-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 163361330 |
| Molecular Formula | C26H19F5N4O3 |
| Molecular Weight | 530.45 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | N-[3-(diaminomethylidenecarbamoyl)-4-fluorophenyl]-2-(4-fluoro-2-methylphenoxy)-5-prop-1-ynyl-4-(trifluoromethyl)benzamide |
| SMILES | CC#Cc1cc(C(=O)Nc2ccc(F)c(C(=O)N=C(N)N)c2)c(Oc2ccc(F)cc2C)cc1C(F)(F)F |
| InChI | InChI=1S/C26H19F5N4O3/c1-3-4-14-10-18(24(37)34-16-6-7-20(28)17(11-16)23(36)35-25(32)33)22(12-19(14)26(29,30)31)38-21-8-5-15(27)9-13(21)2/h5-12H,1-2H3,(H,34,37)(H4,32,33,35,36) |
| InChIKey | VRWXFTUKRPGAOM-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.45 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|