C24H19ClN4O3 — CID 163363104
(2-chloro-4-phenoxyphenyl)-[4-[(2S)-1-hydroxypropan-2-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-12-yl]methanone (PubChem CID 163363104) has the molecular formula C24H19ClN4O3 and a molecular weight of 446.89 g/mol. Its IUPAC name is (2-chloro-4-phenoxyphenyl)-[4-[(2S)-1-hydroxypropan-2-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-12-yl]methanone.
| Compound Name | (2-chloro-4-phenoxyphenyl)-[4-[(2S)-1-hydroxypropan-2-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-12-yl]methanone |
|---|---|
| PubChem CID | 163363104 |
| Molecular Formula | C24H19ClN4O3 |
| Molecular Weight | 446.89 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | (2-chloro-4-phenoxyphenyl)-[4-[(2S)-1-hydroxypropan-2-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-12-yl]methanone |
| SMILES | C[C@H](CO)c1nc2c(cnc3[nH]cc(C(=O)c4ccc(Oc5ccccc5)cc4Cl)c32)[nH]1 |
| InChI | InChI=1S/C24H19ClN4O3/c1-13(12-30)23-28-19-11-27-24-20(21(19)29-23)17(10-26-24)22(31)16-8-7-15(9-18(16)25)32-14-5-3-2-4-6-14/h2-11,13,30H,12H2,1H3,(H,26,27)(H,28,29)/t13-/m1/s1 |
| InChIKey | OSAACKVGEDROEN-CYBMUJFWSA-N |
| XLogP | 5.21 |
| TPSA | 103.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.89 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |