C30H30Cl2N4O5 — CID 163363121
tert-butyl N-[butan-2-yl-[4-chloro-3-(2-chloro-4-phenoxybenzoyl)-1H-pyrrolo[2,3-b]pyridine-5-carbonyl]amino]carbamate (PubChem CID 163363121) has the molecular formula C30H30Cl2N4O5 and a molecular weight of 597.50 g/mol. Its IUPAC name is tert-butyl N-[butan-2-yl-[4-chloro-3-(2-chloro-4-phenoxybenzoyl)-1H-pyrrolo[2,3-b]pyridine-5-carbonyl]amino]carbamate.
| Compound Name | tert-butyl N-[butan-2-yl-[4-chloro-3-(2-chloro-4-phenoxybenzoyl)-1H-pyrrolo[2,3-b]pyridine-5-carbonyl]amino]carbamate |
|---|---|
| PubChem CID | 163363121 |
| Molecular Formula | C30H30Cl2N4O5 |
| Molecular Weight | 597.50 g/mol |
| Exact Mass | 596.16 |
| IUPAC Name | tert-butyl N-[butan-2-yl-[4-chloro-3-(2-chloro-4-phenoxybenzoyl)-1H-pyrrolo[2,3-b]pyridine-5-carbonyl]amino]carbamate |
| SMILES | CCC(C)N(NC(=O)OC(C)(C)C)C(=O)c1cnc2[nH]cc(C(=O)c3ccc(Oc4ccccc4)cc3Cl)c2c1Cl |
| InChI | InChI=1S/C30H30Cl2N4O5/c1-6-17(2)36(35-29(39)41-30(3,4)5)28(38)22-16-34-27-24(25(22)32)21(15-33-27)26(37)20-13-12-19(14-23(20)31)40-18-10-8-7-9-11-18/h7-17H,6H2,1-5H3,(H,33,34)(H,35,39) |
| InChIKey | NLCMLDKHDPVISK-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 113.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.50 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|